C30H27F2N3O4 — CID 158489495
5-[4-[3-fluoro-4-[3-(2-fluoro-5-methylphenyl)-2-oxopropyl]phenoxy]-2-pyridinyl]-N-(4-oxobutyl)-1H-pyrrole-3-carboxamide (PubChem CID 158489495) has the molecular formula C30H27F2N3O4 and a molecular weight of 531.56 g/mol. Its IUPAC name is 5-[4-[3-fluoro-4-[3-(2-fluoro-5-methylphenyl)-2-oxopropyl]phenoxy]-2-pyridinyl]-N-(4-oxobutyl)-1H-pyrrole-3-carboxamide.
| Compound Name | 5-[4-[3-fluoro-4-[3-(2-fluoro-5-methylphenyl)-2-oxopropyl]phenoxy]-2-pyridinyl]-N-(4-oxobutyl)-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 158489495 |
| Molecular Formula | C30H27F2N3O4 |
| Molecular Weight | 531.56 g/mol |
| Exact Mass | 531.20 |
| IUPAC Name | 5-[4-[3-fluoro-4-[3-(2-fluoro-5-methylphenyl)-2-oxopropyl]phenoxy]-2-pyridinyl]-N-(4-oxobutyl)-1H-pyrrole-3-carboxamide |
| SMILES | Cc1ccc(F)c(CC(=O)Cc2ccc(Oc3ccnc(-c4cc(C(=O)NCCCC=O)c[nH]4)c3)cc2F)c1 |
| InChI | InChI=1S/C30H27F2N3O4/c1-19-4-7-26(31)21(12-19)14-23(37)13-20-5-6-24(16-27(20)32)39-25-8-10-33-29(17-25)28-15-22(18-35-28)30(38)34-9-2-3-11-36/h4-8,10-12,15-18,35H,2-3,9,13-14H2,1H3,(H,34,38) |
| InChIKey | HINDTTHBPRYQQG-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.56 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|