C32H32FN3O5 — CID 58167814
ethyl 4-[[5-[4-[4-[3-(2-fluoro-5-methylphenyl)-2-oxopropyl]phenoxy]-2-pyridinyl]-1H-pyrrole-3-carbonyl]amino]butanoate (PubChem CID 58167814) has the molecular formula C32H32FN3O5 and a molecular weight of 557.62 g/mol. Its IUPAC name is ethyl 4-[[5-[4-[4-[3-(2-fluoro-5-methylphenyl)-2-oxopropyl]phenoxy]-2-pyridinyl]-1H-pyrrole-3-carbonyl]amino]butanoate.
| Compound Name | ethyl 4-[[5-[4-[4-[3-(2-fluoro-5-methylphenyl)-2-oxopropyl]phenoxy]-2-pyridinyl]-1H-pyrrole-3-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 58167814 |
| Molecular Formula | C32H32FN3O5 |
| Molecular Weight | 557.62 g/mol |
| Exact Mass | 557.23 |
| IUPAC Name | ethyl 4-[[5-[4-[4-[3-(2-fluoro-5-methylphenyl)-2-oxopropyl]phenoxy]-2-pyridinyl]-1H-pyrrole-3-carbonyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)c1c[nH]c(-c2cc(Oc3ccc(CC(=O)Cc4cc(C)ccc4F)cc3)ccn2)c1 |
| InChI | InChI=1S/C32H32FN3O5/c1-3-40-31(38)5-4-13-35-32(39)24-18-29(36-20-24)30-19-27(12-14-34-30)41-26-9-7-22(8-10-26)16-25(37)17-23-15-21(2)6-11-28(23)33/h6-12,14-15,18-20,36H,3-5,13,16-17H2,1-2H3,(H,35,39) |
| InChIKey | XGYQCXRDLXYPSE-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.62 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|