C13H18O3 — CID 15317716
2-but-3-enyl-2-methyl-5,6,7,8-tetrahydro-1,3-benzodioxin-4-one (PubChem CID 15317716) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is 2-but-3-enyl-2-methyl-5,6,7,8-tetrahydro-1,3-benzodioxin-4-one.
| Compound Name | 2-but-3-enyl-2-methyl-5,6,7,8-tetrahydro-1,3-benzodioxin-4-one |
|---|---|
| PubChem CID | 15317716 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 2-but-3-enyl-2-methyl-5,6,7,8-tetrahydro-1,3-benzodioxin-4-one |
| SMILES | C=CCCC1(C)OC(=O)C2=C(CCCC2)O1 |
| InChI | InChI=1S/C13H18O3/c1-3-4-9-13(2)15-11-8-6-5-7-10(11)12(14)16-13/h3H,1,4-9H2,2H3 |
| InChIKey | VSGMTRFCYXVMHQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|