C14H20O3 — CID 15317722
2-methyl-2-pent-4-enyl-5,6,7,8-tetrahydro-1,3-benzodioxin-4-one (PubChem CID 15317722) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is 2-methyl-2-pent-4-enyl-5,6,7,8-tetrahydro-1,3-benzodioxin-4-one.
| Compound Name | 2-methyl-2-pent-4-enyl-5,6,7,8-tetrahydro-1,3-benzodioxin-4-one |
|---|---|
| PubChem CID | 15317722 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 2-methyl-2-pent-4-enyl-5,6,7,8-tetrahydro-1,3-benzodioxin-4-one |
| SMILES | C=CCCCC1(C)OC(=O)C2=C(CCCC2)O1 |
| InChI | InChI=1S/C14H20O3/c1-3-4-7-10-14(2)16-12-9-6-5-8-11(12)13(15)17-14/h3H,1,4-10H2,2H3 |
| InChIKey | OTGHOUKEECLBIQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|