C21H12N6O3S2 — CID 15319438
4-[(15-oxo-14-phenyl-17-thia-2,9,12,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12-heptaen-13-yl)sulfanyl]pyrazolidine-3,5-dione (PubChem CID 15319438) has the molecular formula C21H12N6O3S2 and a molecular weight of 460.50 g/mol. Its IUPAC name is 4-[(15-oxo-14-phenyl-17-thia-2,9,12,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12-heptaen-13-yl)sulfanyl]pyrazolidine-3,5-dione.
| Compound Name | 4-[(15-oxo-14-phenyl-17-thia-2,9,12,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12-heptaen-13-yl)sulfanyl]pyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 15319438 |
| Molecular Formula | C21H12N6O3S2 |
| Molecular Weight | 460.50 g/mol |
| Exact Mass | 460.04 |
| IUPAC Name | 4-[(15-oxo-14-phenyl-17-thia-2,9,12,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12-heptaen-13-yl)sulfanyl]pyrazolidine-3,5-dione |
| SMILES | O=C1NNC(=O)C1Sc1nc2c(sc3nc4ccccc4nc32)c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C21H12N6O3S2/c28-17-16(18(29)26-25-17)32-21-24-13-14-19(23-12-9-5-4-8-11(12)22-14)31-15(13)20(30)27(21)10-6-2-1-3-7-10/h1-9,16H,(H,25,28)(H,26,29) |
| InChIKey | WVLJQYFIBKSSAK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 118.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.50 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|