C25H27NO4 — CID 153211729
2-[4-[[3-(4-ethoxy-2,6-dimethylphenyl)phenyl]methylamino]phenoxy]acetic acid (PubChem CID 153211729) has the molecular formula C25H27NO4 and a molecular weight of 405.49 g/mol. Its IUPAC name is 2-[4-[[3-(4-ethoxy-2,6-dimethylphenyl)phenyl]methylamino]phenoxy]acetic acid.
| Compound Name | 2-[4-[[3-(4-ethoxy-2,6-dimethylphenyl)phenyl]methylamino]phenoxy]acetic acid |
|---|---|
| PubChem CID | 153211729 |
| Molecular Formula | C25H27NO4 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 2-[4-[[3-(4-ethoxy-2,6-dimethylphenyl)phenyl]methylamino]phenoxy]acetic acid |
| SMILES | CCOc1cc(C)c(-c2cccc(CNc3ccc(OCC(=O)O)cc3)c2)c(C)c1 |
| InChI | InChI=1S/C25H27NO4/c1-4-29-23-12-17(2)25(18(3)13-23)20-7-5-6-19(14-20)15-26-21-8-10-22(11-9-21)30-16-24(27)28/h5-14,26H,4,15-16H2,1-3H3,(H,27,28) |
| InChIKey | WLXUAGIRJMUEEW-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|