C26H29ClFN3O3 — CID 153217085
1-[2-[[1-(4-chloro-2-fluorobenzoyl)piperidin-4-yl]methyl]-6-methylindazol-5-yl]-4-methoxybutan-1-one (PubChem CID 153217085) has the molecular formula C26H29ClFN3O3 and a molecular weight of 485.99 g/mol. Its IUPAC name is 1-[2-[[1-(4-chloro-2-fluorobenzoyl)piperidin-4-yl]methyl]-6-methylindazol-5-yl]-4-methoxybutan-1-one.
| Compound Name | 1-[2-[[1-(4-chloro-2-fluorobenzoyl)piperidin-4-yl]methyl]-6-methylindazol-5-yl]-4-methoxybutan-1-one |
|---|---|
| PubChem CID | 153217085 |
| Molecular Formula | C26H29ClFN3O3 |
| Molecular Weight | 485.99 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | 1-[2-[[1-(4-chloro-2-fluorobenzoyl)piperidin-4-yl]methyl]-6-methylindazol-5-yl]-4-methoxybutan-1-one |
| SMILES | COCCCC(=O)c1cc2cn(CC3CCN(C(=O)c4ccc(Cl)cc4F)CC3)nc2cc1C |
| InChI | InChI=1S/C26H29ClFN3O3/c1-17-12-24-19(13-22(17)25(32)4-3-11-34-2)16-31(29-24)15-18-7-9-30(10-8-18)26(33)21-6-5-20(27)14-23(21)28/h5-6,12-14,16,18H,3-4,7-11,15H2,1-2H3 |
| InChIKey | WMXPDUSOWQSUER-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.99 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|