C11H8N4 — CID 15321802
(7-cyanoimino-2,3-dihydro-1H-inden-4-ylidene)cyanamide (PubChem CID 15321802) has the molecular formula C11H8N4 and a molecular weight of 196.21 g/mol. Its IUPAC name is (7-cyanoimino-2,3-dihydro-1H-inden-4-ylidene)cyanamide.
| Compound Name | (7-cyanoimino-2,3-dihydro-1H-inden-4-ylidene)cyanamide |
|---|---|
| PubChem CID | 15321802 |
| Molecular Formula | C11H8N4 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | (7-cyanoimino-2,3-dihydro-1H-inden-4-ylidene)cyanamide |
| SMILES | N#C/N=C1\C=C/C(=N\C#N)C2=C1CCC2 |
| InChI | InChI=1S/C11H8N4/c12-6-14-10-4-5-11(15-7-13)9-3-1-2-8(9)10/h4-5H,1-3H2/b14-10+,15-11+ |
| InChIKey | NALIQRARZBLCJN-WFYKWJGLSA-N |
| XLogP | 1.88 |
| TPSA | 72.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|