C18H20Cl2N4S — CID 153221115
6-chloro-N-[1-[(3-chlorophenyl)methyl]piperidin-4-yl]-5,6-dihydrothieno[2,3-d]pyrimidin-4-amine (PubChem CID 153221115) has the molecular formula C18H20Cl2N4S and a molecular weight of 395.36 g/mol. Its IUPAC name is 6-chloro-N-[1-[(3-chlorophenyl)methyl]piperidin-4-yl]-5,6-dihydrothieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 6-chloro-N-[1-[(3-chlorophenyl)methyl]piperidin-4-yl]-5,6-dihydrothieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 153221115 |
| Molecular Formula | C18H20Cl2N4S |
| Molecular Weight | 395.36 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 6-chloro-N-[1-[(3-chlorophenyl)methyl]piperidin-4-yl]-5,6-dihydrothieno[2,3-d]pyrimidin-4-amine |
| SMILES | Clc1cccc(CN2CCC(Nc3ncnc4c3CC(Cl)S4)CC2)c1 |
| InChI | InChI=1S/C18H20Cl2N4S/c19-13-3-1-2-12(8-13)10-24-6-4-14(5-7-24)23-17-15-9-16(20)25-18(15)22-11-21-17/h1-3,8,11,14,16H,4-7,9-10H2,(H,21,22,23) |
| InChIKey | WNRIBNLPYTZDTG-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.36 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|