C34H22N4O4S2 — CID 15323959
5-(5-oxo-1,3-diphenyl-4H-pyrazol-4-yl)-2-(5-oxo-1,3-diphenylpyrazol-4-ylidene)-1,3-dithiane-4,6-dione (PubChem CID 15323959) has the molecular formula C34H22N4O4S2 and a molecular weight of 614.71 g/mol. Its IUPAC name is 5-(5-oxo-1,3-diphenyl-4H-pyrazol-4-yl)-2-(5-oxo-1,3-diphenylpyrazol-4-ylidene)-1,3-dithiane-4,6-dione.
| Compound Name | 5-(5-oxo-1,3-diphenyl-4H-pyrazol-4-yl)-2-(5-oxo-1,3-diphenylpyrazol-4-ylidene)-1,3-dithiane-4,6-dione |
|---|---|
| PubChem CID | 15323959 |
| Molecular Formula | C34H22N4O4S2 |
| Molecular Weight | 614.71 g/mol |
| Exact Mass | 614.11 |
| IUPAC Name | 5-(5-oxo-1,3-diphenyl-4H-pyrazol-4-yl)-2-(5-oxo-1,3-diphenylpyrazol-4-ylidene)-1,3-dithiane-4,6-dione |
| SMILES | O=C1SC(=C2C(=O)N(c3ccccc3)N=C2c2ccccc2)SC(=O)C1C1C(=O)N(c2ccccc2)N=C1c1ccccc1 |
| InChI | InChI=1S/C34H22N4O4S2/c39-30-25(28(21-13-5-1-6-14-21)35-37(30)23-17-9-3-10-18-23)26-32(41)43-34(44-33(26)42)27-29(22-15-7-2-8-16-22)36-38(31(27)40)24-19-11-4-12-20-24/h1-20,25-26H/b34-27- |
| InChIKey | ZSKWRTYFHGVYKN-YLHCSOALSA-N |
| XLogP | 5.87 |
| TPSA | 99.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.71 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|