C9H14N2O — CID 153243583
2,6-dimethyl-4-propan-2-ylpyridazin-3-one (PubChem CID 153243583) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is 2,6-dimethyl-4-propan-2-ylpyridazin-3-one.
| Compound Name | 2,6-dimethyl-4-propan-2-ylpyridazin-3-one |
|---|---|
| PubChem CID | 153243583 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 2,6-dimethyl-4-propan-2-ylpyridazin-3-one |
| SMILES | Cc1cc(C(C)C)c(=O)n(C)n1 |
| InChI | InChI=1S/C9H14N2O/c1-6(2)8-5-7(3)10-11(4)9(8)12/h5-6H,1-4H3 |
| InChIKey | WRXTWACPJIMZJT-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |