C9H15N — CID 153247341
N-[(3E)-6-methylhepta-1,3-dien-4-yl]methanimine (PubChem CID 153247341) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is N-[(3E)-6-methylhepta-1,3-dien-4-yl]methanimine.
| Compound Name | N-[(3E)-6-methylhepta-1,3-dien-4-yl]methanimine |
|---|---|
| PubChem CID | 153247341 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | N-[(3E)-6-methylhepta-1,3-dien-4-yl]methanimine |
| SMILES | C=C/C=C(\CC(C)C)N=C |
| InChI | InChI=1S/C9H15N/c1-5-6-9(10-4)7-8(2)3/h5-6,8H,1,4,7H2,2-3H3/b9-6+ |
| InChIKey | WSQBLNZNQPBXFO-RMKNXTFCSA-N |
| XLogP | 2.80 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|