C58H43B2N4OPt-3 — CID 153276298
2-[[5,10-bis(2,6-dimethylphenyl)-3-(3-phenyl-2H-benzimidazol-2-id-1-yl)-2H-boranthren-2-id-1-yl]oxy]-9-pyridin-2-yl-1H-carbazol-1-ide;platinum (PubChem CID 153276298) has the molecular formula C58H43B2N4OPt-3 and a molecular weight of 1028.71 g/mol. Its IUPAC name is 2-[[5,10-bis(2,6-dimethylphenyl)-3-(3-phenyl-2H-benzimidazol-2-id-1-yl)-2H-boranthren-2-id-1-yl]oxy]-9-pyridin-2-yl-1H-carbazol-1-ide;platinum.
| Compound Name | 2-[[5,10-bis(2,6-dimethylphenyl)-3-(3-phenyl-2H-benzimidazol-2-id-1-yl)-2H-boranthren-2-id-1-yl]oxy]-9-pyridin-2-yl-1H-carbazol-1-ide;platinum |
|---|---|
| PubChem CID | 153276298 |
| Molecular Formula | C58H43B2N4OPt-3 |
| Molecular Weight | 1028.71 g/mol |
| Exact Mass | 1028.33 |
| IUPAC Name | 2-[[5,10-bis(2,6-dimethylphenyl)-3-(3-phenyl-2H-benzimidazol-2-id-1-yl)-2H-boranthren-2-id-1-yl]oxy]-9-pyridin-2-yl-1H-carbazol-1-ide;platinum |
| SMILES | Cc1cccc(C)c1B1c2ccccc2B(c2c(C)cccc2C)c2c(Oc3[c-]c4c(cc3)c3ccccc3n4-c3ccccn3)[c-]c(N3[CH-]N(c4ccccc4)c4ccccc43)cc21.[Pt] |
| InChI | InChI=1S/C58H43B2N4O.Pt/c1-38-18-16-19-39(2)56(38)59-47-25-9-10-26-48(47)60(57-40(3)20-17-21-41(57)4)58-49(59)34-43(63-37-62(42-22-6-5-7-23-42)51-28-12-13-29-52(51)63)35-54(58)65-44-31-32-46-45-24-8-11-27-50(45)64(53(46)36-44)55-30-14-15-33-61-55;/h5-34,37H,1-4H3;/q-3; |
| InChIKey | JSVCWJOSQSOOCL-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1028.71 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|