C28H35BO8 — CID 153279599
ethyl 2-[2-[[2-(2-hydroxyethyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-5-yl]methoxy]-4-methoxyphenyl]acetate (PubChem CID 153279599) has the molecular formula C28H35BO8 and a molecular weight of 510.39 g/mol. Its IUPAC name is ethyl 2-[2-[[2-(2-hydroxyethyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-5-yl]methoxy]-4-methoxyphenyl]acetate.
| Compound Name | ethyl 2-[2-[[2-(2-hydroxyethyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-5-yl]methoxy]-4-methoxyphenyl]acetate |
|---|---|
| PubChem CID | 153279599 |
| Molecular Formula | C28H35BO8 |
| Molecular Weight | 510.39 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | ethyl 2-[2-[[2-(2-hydroxyethyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-5-yl]methoxy]-4-methoxyphenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(OC)cc1OCc1cc(B2OC(C)(C)C(C)(C)O2)c2oc(CCO)cc2c1 |
| InChI | InChI=1S/C28H35BO8/c1-7-33-25(31)15-19-8-9-21(32-6)16-24(19)34-17-18-12-20-14-22(10-11-30)35-26(20)23(13-18)29-36-27(2,3)28(4,5)37-29/h8-9,12-14,16,30H,7,10-11,15,17H2,1-6H3 |
| InChIKey | KZBZIBHRHHHIEH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|