C31H20N3OPtS- — CID 153280217
2-[4-(3-isoquinolin-3-ylsulfanylbenzene-2-id-1-yl)-6-phenylpyrimidin-2-yl]phenol;platinum (PubChem CID 153280217) has the molecular formula C31H20N3OPtS- and a molecular weight of 677.67 g/mol. Its IUPAC name is 2-[4-(3-isoquinolin-3-ylsulfanylbenzene-2-id-1-yl)-6-phenylpyrimidin-2-yl]phenol;platinum.
| Compound Name | 2-[4-(3-isoquinolin-3-ylsulfanylbenzene-2-id-1-yl)-6-phenylpyrimidin-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 153280217 |
| Molecular Formula | C31H20N3OPtS- |
| Molecular Weight | 677.67 g/mol |
| Exact Mass | 677.10 |
| IUPAC Name | 2-[4-(3-isoquinolin-3-ylsulfanylbenzene-2-id-1-yl)-6-phenylpyrimidin-2-yl]phenol;platinum |
| SMILES | Oc1ccccc1-c1nc(-c2[c-]c(Sc3cc4ccccc4cn3)ccc2)cc(-c2ccccc2)n1.[Pt] |
| InChI | InChI=1S/C31H20N3OS.Pt/c35-29-16-7-6-15-26(29)31-33-27(21-9-2-1-3-10-21)19-28(34-31)23-13-8-14-25(17-23)36-30-18-22-11-4-5-12-24(22)20-32-30;/h1-16,18-20,35H;/q-1; |
| InChIKey | BKDZJEALIIEJJK-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.67 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|