C25H22N3OPtS- — CID 153280197
2-tert-butyl-6-[4-(3-pyridin-2-ylsulfanylbenzene-2-id-1-yl)pyrimidin-2-yl]phenol;platinum (PubChem CID 153280197) has the molecular formula C25H22N3OPtS- and a molecular weight of 607.62 g/mol. Its IUPAC name is 2-tert-butyl-6-[4-(3-pyridin-2-ylsulfanylbenzene-2-id-1-yl)pyrimidin-2-yl]phenol;platinum.
| Compound Name | 2-tert-butyl-6-[4-(3-pyridin-2-ylsulfanylbenzene-2-id-1-yl)pyrimidin-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 153280197 |
| Molecular Formula | C25H22N3OPtS- |
| Molecular Weight | 607.62 g/mol |
| Exact Mass | 607.11 |
| IUPAC Name | 2-tert-butyl-6-[4-(3-pyridin-2-ylsulfanylbenzene-2-id-1-yl)pyrimidin-2-yl]phenol;platinum |
| SMILES | CC(C)(C)c1cccc(-c2nccc(-c3[c-]c(Sc4ccccn4)ccc3)n2)c1O.[Pt] |
| InChI | InChI=1S/C25H22N3OS.Pt/c1-25(2,3)20-11-7-10-19(23(20)29)24-27-15-13-21(28-24)17-8-6-9-18(16-17)30-22-12-4-5-14-26-22;/h4-15,29H,1-3H3;/q-1; |
| InChIKey | KWGBSPDKINQKRE-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.62 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|