C39H36N3OPtS- — CID 153280281
2,4-ditert-butyl-6-[2-(3-isoquinolin-3-ylsulfanylbenzene-2-id-1-yl)-6-phenylpyrimidin-4-yl]phenol;platinum (PubChem CID 153280281) has the molecular formula C39H36N3OPtS- and a molecular weight of 789.88 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[2-(3-isoquinolin-3-ylsulfanylbenzene-2-id-1-yl)-6-phenylpyrimidin-4-yl]phenol;platinum.
| Compound Name | 2,4-ditert-butyl-6-[2-(3-isoquinolin-3-ylsulfanylbenzene-2-id-1-yl)-6-phenylpyrimidin-4-yl]phenol;platinum |
|---|---|
| PubChem CID | 153280281 |
| Molecular Formula | C39H36N3OPtS- |
| Molecular Weight | 789.88 g/mol |
| Exact Mass | 789.22 |
| IUPAC Name | 2,4-ditert-butyl-6-[2-(3-isoquinolin-3-ylsulfanylbenzene-2-id-1-yl)-6-phenylpyrimidin-4-yl]phenol;platinum |
| SMILES | CC(C)(C)c1cc(-c2cc(-c3ccccc3)nc(-c3[c-]c(Sc4cc5ccccc5cn4)ccc3)n2)c(O)c(C(C)(C)C)c1.[Pt] |
| InChI | InChI=1S/C39H36N3OS.Pt/c1-38(2,3)29-21-31(36(43)32(22-29)39(4,5)6)34-23-33(25-13-8-7-9-14-25)41-37(42-34)27-17-12-18-30(19-27)44-35-20-26-15-10-11-16-28(26)24-40-35;/h7-18,20-24,43H,1-6H3;/q-1; |
| InChIKey | AQCRJZFYDJAGEF-UHFFFAOYSA-N |
| XLogP | 10.28 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.88 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|