C35H34N3OPtS- — CID 153280352
2-[4-(3,5-ditert-butylphenyl)-6-(3-pyridin-2-ylsulfanylbenzene-2-id-1-yl)pyrimidin-2-yl]phenol;platinum (PubChem CID 153280352) has the molecular formula C35H34N3OPtS- and a molecular weight of 739.82 g/mol. Its IUPAC name is 2-[4-(3,5-ditert-butylphenyl)-6-(3-pyridin-2-ylsulfanylbenzene-2-id-1-yl)pyrimidin-2-yl]phenol;platinum.
| Compound Name | 2-[4-(3,5-ditert-butylphenyl)-6-(3-pyridin-2-ylsulfanylbenzene-2-id-1-yl)pyrimidin-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 153280352 |
| Molecular Formula | C35H34N3OPtS- |
| Molecular Weight | 739.82 g/mol |
| Exact Mass | 739.21 |
| IUPAC Name | 2-[4-(3,5-ditert-butylphenyl)-6-(3-pyridin-2-ylsulfanylbenzene-2-id-1-yl)pyrimidin-2-yl]phenol;platinum |
| SMILES | CC(C)(C)c1cc(-c2cc(-c3[c-]c(Sc4ccccn4)ccc3)nc(-c3ccccc3O)n2)cc(C(C)(C)C)c1.[Pt] |
| InChI | InChI=1S/C35H34N3OS.Pt/c1-34(2,3)25-18-24(19-26(21-25)35(4,5)6)30-22-29(37-33(38-30)28-14-7-8-15-31(28)39)23-12-11-13-27(20-23)40-32-16-9-10-17-36-32;/h7-19,21-22,39H,1-6H3;/q-1; |
| InChIKey | KLABBMUBNOEAJX-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.82 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|