C6H9NaO10S — CID 153280733
sodium [(2R,3R,4S,5S,6R)-6-carboxy-2,4,5-trihydroxyoxan-3-yl] sulfate (PubChem CID 153280733) has the molecular formula C6H9NaO10S and a molecular weight of 296.19 g/mol. Its IUPAC name is sodium [(2R,3R,4S,5S,6R)-6-carboxy-2,4,5-trihydroxyoxan-3-yl] sulfate.
| Compound Name | sodium [(2R,3R,4S,5S,6R)-6-carboxy-2,4,5-trihydroxyoxan-3-yl] sulfate |
|---|---|
| PubChem CID | 153280733 |
| Molecular Formula | C6H9NaO10S |
| Molecular Weight | 296.19 g/mol |
| Exact Mass | 295.98 |
| IUPAC Name | sodium [(2R,3R,4S,5S,6R)-6-carboxy-2,4,5-trihydroxyoxan-3-yl] sulfate |
| SMILES | O=C(O)[C@@H]1O[C@@H](O)[C@H](OS(=O)(=O)[O-])[C@@H](O)[C@@H]1O.[Na+] |
| InChI | InChI=1S/C6H10O10S.Na/c7-1-2(8)4(16-17(12,13)14)6(11)15-3(1)5(9)10;/h1-4,6-8,11H,(H,9,10)(H,12,13,14);/q;+1/p-1/t1-,2-,3+,4+,6+;/m0./s1 |
| InChIKey | CQHWKZDBLPZZAK-UXFYZXHVSA-M |
| XLogP | -6.64 |
| TPSA | 173.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.19 |
| LogP ≤ 5 | -6.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|