C6H10O9S — CID 175954737
(2R,3R,4S,5R,6R)-3,4,6-trihydroxy-5-sulfooxane-2-carboxylic acid (PubChem CID 175954737) has the molecular formula C6H10O9S and a molecular weight of 258.20 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-3,4,6-trihydroxy-5-sulfooxane-2-carboxylic acid.
| Compound Name | (2R,3R,4S,5R,6R)-3,4,6-trihydroxy-5-sulfooxane-2-carboxylic acid |
|---|---|
| PubChem CID | 175954737 |
| Molecular Formula | C6H10O9S |
| Molecular Weight | 258.20 g/mol |
| Exact Mass | 258.00 |
| IUPAC Name | (2R,3R,4S,5R,6R)-3,4,6-trihydroxy-5-sulfooxane-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1O[C@@H](O)[C@H](S(=O)(=O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C6H10O9S/c7-1-2(8)4(16(12,13)14)6(11)15-3(1)5(9)10/h1-4,6-8,11H,(H,9,10)(H,12,13,14)/t1-,2+,3-,4-,6-/m1/s1 |
| InChIKey | DNRLOXZSYXLZND-PTPXTALPSA-N |
| XLogP | -3.23 |
| TPSA | 161.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.20 |
| LogP ≤ 5 | -3.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|