C82H42 — CID 153283218
9-[3-[3,4-bis(2,3-diethynylphenyl)phenyl]-5-[3,5-bis(2,3-diethynylphenyl)phenyl]phenyl]-10-(3,4-diethynylphenyl)anthracene (PubChem CID 153283218) has the molecular formula C82H42 and a molecular weight of 1027.24 g/mol. Its IUPAC name is 9-[3-[3,4-bis(2,3-diethynylphenyl)phenyl]-5-[3,5-bis(2,3-diethynylphenyl)phenyl]phenyl]-10-(3,4-diethynylphenyl)anthracene.
| Compound Name | 9-[3-[3,4-bis(2,3-diethynylphenyl)phenyl]-5-[3,5-bis(2,3-diethynylphenyl)phenyl]phenyl]-10-(3,4-diethynylphenyl)anthracene |
|---|---|
| PubChem CID | 153283218 |
| Molecular Formula | C82H42 |
| Molecular Weight | 1027.24 g/mol |
| Exact Mass | 1026.33 |
| IUPAC Name | 9-[3-[3,4-bis(2,3-diethynylphenyl)phenyl]-5-[3,5-bis(2,3-diethynylphenyl)phenyl]phenyl]-10-(3,4-diethynylphenyl)anthracene |
| SMILES | C#Cc1ccc(-c2c3ccccc3c(-c3cc(-c4cc(-c5cccc(C#C)c5C#C)cc(-c5cccc(C#C)c5C#C)c4)cc(-c4ccc(-c5cccc(C#C)c5C#C)c(-c5cccc(C#C)c5C#C)c4)c3)c3ccccc23)cc1C#C |
| InChI | InChI=1S/C82H42/c1-11-53-41-42-60(45-58(53)16-6)81-76-33-21-23-35-78(76)82(79-36-24-22-34-77(79)81)66-49-61(59-43-44-75(73-39-27-31-56(14-4)69(73)19-9)80(52-59)74-40-28-32-57(15-5)70(74)20-10)46-62(50-66)63-47-64(71-37-25-29-54(12-2)67(71)17-7)51-65(48-63)72-38-26-30-55(13-3)68(72)18-8/h1-10,21-52H |
| InChIKey | CSFOIGZJSBVPGW-UHFFFAOYSA-N |
| XLogP | 17.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 82 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1027.24 |
| LogP ≤ 5 | 17.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|