C90H50 — CID 153283424
9,10-bis[3-[2,4-bis(2,3-diethynylphenyl)phenyl]-5-phenylphenyl]anthracene (PubChem CID 153283424) has the molecular formula C90H50 and a molecular weight of 1131.39 g/mol. Its IUPAC name is 9,10-bis[3-[2,4-bis(2,3-diethynylphenyl)phenyl]-5-phenylphenyl]anthracene.
| Compound Name | 9,10-bis[3-[2,4-bis(2,3-diethynylphenyl)phenyl]-5-phenylphenyl]anthracene |
|---|---|
| PubChem CID | 153283424 |
| Molecular Formula | C90H50 |
| Molecular Weight | 1131.39 g/mol |
| Exact Mass | 1130.39 |
| IUPAC Name | 9,10-bis[3-[2,4-bis(2,3-diethynylphenyl)phenyl]-5-phenylphenyl]anthracene |
| SMILES | C#Cc1cccc(-c2ccc(-c3cc(-c4ccccc4)cc(-c4c5ccccc5c(-c5cc(-c6ccccc6)cc(-c6ccc(-c7cccc(C#C)c7C#C)cc6-c6cccc(C#C)c6C#C)c5)c5ccccc45)c3)c(-c3cccc(C#C)c3C#C)c2)c1C#C |
| InChI | InChI=1S/C90H50/c1-9-59-35-27-43-77(73(59)13-5)65-47-49-79(87(57-65)81-45-29-37-61(11-3)75(81)15-7)69-51-67(63-31-19-17-20-32-63)53-71(55-69)89-83-39-23-25-41-85(83)90(86-42-26-24-40-84(86)89)72-54-68(64-33-21-18-22-34-64)52-70(56-72)80-50-48-66(78-44-28-36-60(10-2)74(78)14-6)58-88(80)82-46-30-38-62(12-4)76(82)16-8/h1-8,17-58H |
| InChIKey | MVAWBAIPWDRBID-UHFFFAOYSA-N |
| XLogP | 20.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 90 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1131.39 |
| LogP ≤ 5 | 20.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|