C18H11ClF2N4OS — CID 153284977
[(1R,11R,12S)-5-chloro-17-(difluoromethoxy)-12λ4-thia-2,9-diazapentacyclo[9.7.1.02,10.03,8.013,18]nonadeca-3(8),4,6,9,13,15,17-heptaen-12-ylidene]cyanamide (PubChem CID 153284977) has the molecular formula C18H11ClF2N4OS and a molecular weight of 404.83 g/mol. Its IUPAC name is [(1R,11R,12S)-5-chloro-17-(difluoromethoxy)-12λ4-thia-2,9-diazapentacyclo[9.7.1.02,10.03,8.013,18]nonadeca-3(8),4,6,9,13,15,17-heptaen-12-ylidene]cyanamide.
| Compound Name | [(1R,11R,12S)-5-chloro-17-(difluoromethoxy)-12λ4-thia-2,9-diazapentacyclo[9.7.1.02,10.03,8.013,18]nonadeca-3(8),4,6,9,13,15,17-heptaen-12-ylidene]cyanamide |
|---|---|
| PubChem CID | 153284977 |
| Molecular Formula | C18H11ClF2N4OS |
| Molecular Weight | 404.83 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | [(1R,11R,12S)-5-chloro-17-(difluoromethoxy)-12λ4-thia-2,9-diazapentacyclo[9.7.1.02,10.03,8.013,18]nonadeca-3(8),4,6,9,13,15,17-heptaen-12-ylidene]cyanamide |
| SMILES | N#C/N=[S@@]1\c2cccc(OC(F)F)c2[C@H]2C[C@@H]1c1nc3ccc(Cl)cc3n12 |
| InChI | InChI=1S/C18H11ClF2N4OS/c19-9-4-5-10-11(6-9)25-12-7-15(17(25)24-10)27(23-8-22)14-3-1-2-13(16(12)14)26-18(20)21/h1-6,12,15,18H,7H2/t12-,15-,27-/m1/s1 |
| InChIKey | FGDBIYYHYZKXBX-YFXXDRJJSA-N |
| XLogP | 4.98 |
| TPSA | 63.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.83 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|