C20H15ClF2N2O2 — CID 147781350
(1R,11S)-5-chloro-18-(difluoromethoxy)-11-methyl-2,9-diazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one (PubChem CID 147781350) has the molecular formula C20H15ClF2N2O2 and a molecular weight of 388.80 g/mol. Its IUPAC name is (1R,11S)-5-chloro-18-(difluoromethoxy)-11-methyl-2,9-diazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one.
| Compound Name | (1R,11S)-5-chloro-18-(difluoromethoxy)-11-methyl-2,9-diazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one |
|---|---|
| PubChem CID | 147781350 |
| Molecular Formula | C20H15ClF2N2O2 |
| Molecular Weight | 388.80 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | (1R,11S)-5-chloro-18-(difluoromethoxy)-11-methyl-2,9-diazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one |
| SMILES | C[C@@]12CC(=O)c3cccc(OC(F)F)c3[C@@H](C1)n1c2nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C20H15ClF2N2O2/c1-20-8-14(25-13-7-10(21)5-6-12(13)24-18(20)25)17-11(15(26)9-20)3-2-4-16(17)27-19(22)23/h2-7,14,19H,8-9H2,1H3/t14-,20+/m1/s1 |
| InChIKey | HHVXRBPYYQHLDP-VLIAUNLRSA-N |
| XLogP | 5.13 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.80 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |