C16H9F2I3O6S — CID 153287467
1,1-difluoro-2-oxo-2-[4-[2-oxo-2-(2,3,5-triiodophenyl)ethyl]phenoxy]ethanesulfonic acid (PubChem CID 153287467) has the molecular formula C16H9F2I3O6S and a molecular weight of 748.02 g/mol. Its IUPAC name is 1,1-difluoro-2-oxo-2-[4-[2-oxo-2-(2,3,5-triiodophenyl)ethyl]phenoxy]ethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-oxo-2-[4-[2-oxo-2-(2,3,5-triiodophenyl)ethyl]phenoxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 153287467 |
| Molecular Formula | C16H9F2I3O6S |
| Molecular Weight | 748.02 g/mol |
| Exact Mass | 747.72 |
| IUPAC Name | 1,1-difluoro-2-oxo-2-[4-[2-oxo-2-(2,3,5-triiodophenyl)ethyl]phenoxy]ethanesulfonic acid |
| SMILES | O=C(Cc1ccc(OC(=O)C(F)(F)S(=O)(=O)O)cc1)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C16H9F2I3O6S/c17-16(18,28(24,25)26)15(23)27-10-3-1-8(2-4-10)5-13(22)11-6-9(19)7-12(20)14(11)21/h1-4,6-7H,5H2,(H,24,25,26) |
| InChIKey | CUEBGTWCWAMNTG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.02 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|