C28H13F6IrN2S- — CID 153289341
4-(3H-1-benzothiophen-3-id-2-yl)-1-[3,4-bis(trifluoromethyl)phenyl]benzo[g]phthalazine;iridium (PubChem CID 153289341) has the molecular formula C28H13F6IrN2S- and a molecular weight of 715.70 g/mol. Its IUPAC name is 4-(3H-1-benzothiophen-3-id-2-yl)-1-[3,4-bis(trifluoromethyl)phenyl]benzo[g]phthalazine;iridium.
| Compound Name | 4-(3H-1-benzothiophen-3-id-2-yl)-1-[3,4-bis(trifluoromethyl)phenyl]benzo[g]phthalazine;iridium |
|---|---|
| PubChem CID | 153289341 |
| Molecular Formula | C28H13F6IrN2S- |
| Molecular Weight | 715.70 g/mol |
| Exact Mass | 716.03 |
| IUPAC Name | 4-(3H-1-benzothiophen-3-id-2-yl)-1-[3,4-bis(trifluoromethyl)phenyl]benzo[g]phthalazine;iridium |
| SMILES | FC(F)(F)c1ccc(-c2nnc(-c3[c-]c4ccccc4s3)c3cc4ccccc4cc23)cc1C(F)(F)F.[Ir] |
| InChI | InChI=1S/C28H13F6N2S.Ir/c29-27(30,31)21-10-9-18(13-22(21)28(32,33)34)25-19-11-15-5-1-2-6-16(15)12-20(19)26(36-35-25)24-14-17-7-3-4-8-23(17)37-24;/h1-13H;/q-1; |
| InChIKey | QNYLLORIDKYABN-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.70 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|