C28H28F2N3O8PS — CID 153289893
[(3R)-2-[(11S)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-6-(methoxymethyl)-9,12-dioxo-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl dihydrogen phosphate (PubChem CID 153289893) has the molecular formula C28H28F2N3O8PS and a molecular weight of 635.58 g/mol. Its IUPAC name is [(3R)-2-[(11S)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-6-(methoxymethyl)-9,12-dioxo-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl dihydrogen phosphate.
| Compound Name | [(3R)-2-[(11S)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-6-(methoxymethyl)-9,12-dioxo-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 153289893 |
| Molecular Formula | C28H28F2N3O8PS |
| Molecular Weight | 635.58 g/mol |
| Exact Mass | 635.13 |
| IUPAC Name | [(3R)-2-[(11S)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-6-(methoxymethyl)-9,12-dioxo-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl dihydrogen phosphate |
| SMILES | COCC1CC[C@@H]2N(C1)C(=O)c1c(OCOP(=O)(O)O)c(=O)ccn1N2[C@@H]1c2ccccc2SCc2c1ccc(F)c2F |
| InChI | InChI=1S/C28H28F2N3O8PS/c1-39-13-16-6-9-23-31(12-16)28(35)26-27(40-15-41-42(36,37)38)21(34)10-11-32(26)33(23)25-17-7-8-20(29)24(30)19(17)14-43-22-5-3-2-4-18(22)25/h2-5,7-8,10-11,16,23,25H,6,9,12-15H2,1H3,(H2,36,37,38)/t16?,23-,25+/m1/s1 |
| InChIKey | LLCWTSYOCPWEML-GEDQLHFXSA-N |
| XLogP | 3.74 |
| TPSA | 130.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.58 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|