C48H31BO4S2 — CID 153293362
11-[3-[3-[3-(3-phenylphenyl)phenyl]phenyl]phenyl]-8λ6,14λ6-dithia-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaene 8,8,14,14-tetraoxide (PubChem CID 153293362) has the molecular formula C48H31BO4S2 and a molecular weight of 746.72 g/mol. Its IUPAC name is 11-[3-[3-[3-(3-phenylphenyl)phenyl]phenyl]phenyl]-8λ6,14λ6-dithia-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaene 8,8,14,14-tetraoxide.
| Compound Name | 11-[3-[3-[3-(3-phenylphenyl)phenyl]phenyl]phenyl]-8λ6,14λ6-dithia-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaene 8,8,14,14-tetraoxide |
|---|---|
| PubChem CID | 153293362 |
| Molecular Formula | C48H31BO4S2 |
| Molecular Weight | 746.72 g/mol |
| Exact Mass | 746.18 |
| IUPAC Name | 11-[3-[3-[3-(3-phenylphenyl)phenyl]phenyl]phenyl]-8λ6,14λ6-dithia-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaene 8,8,14,14-tetraoxide |
| SMILES | O=S1(=O)c2ccccc2B2c3ccccc3S(=O)(=O)c3cc(-c4cccc(-c5cccc(-c6cccc(-c7cccc(-c8ccccc8)c7)c6)c5)c4)cc1c32 |
| InChI | InChI=1S/C48H31BO4S2/c50-54(51)44-24-6-4-22-42(44)49-43-23-5-7-25-45(43)55(52,53)47-31-41(30-46(54)48(47)49)40-21-11-20-39(29-40)38-19-10-18-37(28-38)36-17-9-16-35(27-36)34-15-8-14-33(26-34)32-12-2-1-3-13-32/h1-31H |
| InChIKey | VZFQUULDSMAJRX-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.72 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|