C31H37FO2 — CID 153297066
2-[4-fluoro-2,5-bis(4-pentylphenyl)phenyl]ethyl formate (PubChem CID 153297066) has the molecular formula C31H37FO2 and a molecular weight of 460.63 g/mol. Its IUPAC name is 2-[4-fluoro-2,5-bis(4-pentylphenyl)phenyl]ethyl formate.
| Compound Name | 2-[4-fluoro-2,5-bis(4-pentylphenyl)phenyl]ethyl formate |
|---|---|
| PubChem CID | 153297066 |
| Molecular Formula | C31H37FO2 |
| Molecular Weight | 460.63 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | 2-[4-fluoro-2,5-bis(4-pentylphenyl)phenyl]ethyl formate |
| SMILES | CCCCCc1ccc(-c2cc(CCOC=O)c(-c3ccc(CCCCC)cc3)cc2F)cc1 |
| InChI | InChI=1S/C31H37FO2/c1-3-5-7-9-24-11-15-26(16-12-24)29-22-31(32)30(21-28(29)19-20-34-23-33)27-17-13-25(14-18-27)10-8-6-4-2/h11-18,21-23H,3-10,19-20H2,1-2H3 |
| InChIKey | AHSSNUJXABYTNX-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.63 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|