C11H12N4O2S — CID 153298097
3,6-dimethyl-7-methylsulfanyl-1-prop-2-ynylimidazo[1,2-a][1,3,5]triazine-2,4-dione (PubChem CID 153298097) has the molecular formula C11H12N4O2S and a molecular weight of 264.31 g/mol. Its IUPAC name is 3,6-dimethyl-7-methylsulfanyl-1-prop-2-ynylimidazo[1,2-a][1,3,5]triazine-2,4-dione.
| Compound Name | 3,6-dimethyl-7-methylsulfanyl-1-prop-2-ynylimidazo[1,2-a][1,3,5]triazine-2,4-dione |
|---|---|
| PubChem CID | 153298097 |
| Molecular Formula | C11H12N4O2S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 3,6-dimethyl-7-methylsulfanyl-1-prop-2-ynylimidazo[1,2-a][1,3,5]triazine-2,4-dione |
| SMILES | C#CCn1c(=O)n(C)c(=O)n2c(C)c(SC)nc12 |
| InChI | InChI=1S/C11H12N4O2S/c1-5-6-14-9-12-8(18-4)7(2)15(9)11(17)13(3)10(14)16/h1H,6H2,2-4H3 |
| InChIKey | BPZRXNNGIKCISS-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 61.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|