C30H35F3O4S — CID 153303616
[2,2-dimethyl-4-[2-oxo-3-[4-pentyl-2-(trifluoromethyl)phenyl]thiochromen-7-yl]oxybutyl] propanoate (PubChem CID 153303616) has the molecular formula C30H35F3O4S and a molecular weight of 548.67 g/mol. Its IUPAC name is [2,2-dimethyl-4-[2-oxo-3-[4-pentyl-2-(trifluoromethyl)phenyl]thiochromen-7-yl]oxybutyl] propanoate.
| Compound Name | [2,2-dimethyl-4-[2-oxo-3-[4-pentyl-2-(trifluoromethyl)phenyl]thiochromen-7-yl]oxybutyl] propanoate |
|---|---|
| PubChem CID | 153303616 |
| Molecular Formula | C30H35F3O4S |
| Molecular Weight | 548.67 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | [2,2-dimethyl-4-[2-oxo-3-[4-pentyl-2-(trifluoromethyl)phenyl]thiochromen-7-yl]oxybutyl] propanoate |
| SMILES | CCCCCc1ccc(-c2cc3ccc(OCCC(C)(C)COC(=O)CC)cc3sc2=O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C30H35F3O4S/c1-5-7-8-9-20-10-13-23(25(16-20)30(31,32)33)24-17-21-11-12-22(18-26(21)38-28(24)35)36-15-14-29(3,4)19-37-27(34)6-2/h10-13,16-18H,5-9,14-15,19H2,1-4H3 |
| InChIKey | IUKAMQOOVRCKNY-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.67 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|