C15H15NO2S — CID 15330459
(3aR,4S,7aR)-4-methoxy-2-phenyl-3-sulfanylidene-3a,4,7,7a-tetrahydroisoindol-1-one (PubChem CID 15330459) has the molecular formula C15H15NO2S and a molecular weight of 273.36 g/mol. Its IUPAC name is (3aR,4S,7aR)-4-methoxy-2-phenyl-3-sulfanylidene-3a,4,7,7a-tetrahydroisoindol-1-one.
| Compound Name | (3aR,4S,7aR)-4-methoxy-2-phenyl-3-sulfanylidene-3a,4,7,7a-tetrahydroisoindol-1-one |
|---|---|
| PubChem CID | 15330459 |
| Molecular Formula | C15H15NO2S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | (3aR,4S,7aR)-4-methoxy-2-phenyl-3-sulfanylidene-3a,4,7,7a-tetrahydroisoindol-1-one |
| SMILES | CO[C@H]1C=CC[C@H]2C(=O)N(c3ccccc3)C(=S)[C@@H]12 |
| InChI | InChI=1S/C15H15NO2S/c1-18-12-9-5-8-11-13(12)15(19)16(14(11)17)10-6-3-2-4-7-10/h2-7,9,11-13H,8H2,1H3/t11-,12+,13-/m1/s1 |
| InChIKey | CXSJDOBXSWVPLB-FRRDWIJNSA-N |
| XLogP | 2.57 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|