C10H9N3O3S — CID 153305161
3-(3-amino-6-oxo-4H-thieno[2,3-c]pyrrol-5-yl)pyrrolidine-2,5-dione (PubChem CID 153305161) has the molecular formula C10H9N3O3S and a molecular weight of 251.27 g/mol. Its IUPAC name is 3-(3-amino-6-oxo-4H-thieno[2,3-c]pyrrol-5-yl)pyrrolidine-2,5-dione.
| Compound Name | 3-(3-amino-6-oxo-4H-thieno[2,3-c]pyrrol-5-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 153305161 |
| Molecular Formula | C10H9N3O3S |
| Molecular Weight | 251.27 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | 3-(3-amino-6-oxo-4H-thieno[2,3-c]pyrrol-5-yl)pyrrolidine-2,5-dione |
| SMILES | Nc1csc2c1CN(C1CC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C10H9N3O3S/c11-5-3-17-8-4(5)2-13(10(8)16)6-1-7(14)12-9(6)15/h3,6H,1-2,11H2,(H,12,14,15) |
| InChIKey | TWHNLCHXVUAQBR-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.27 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|