C11H10FN3 — CID 153307154
(1R,5S)-3-(4-fluoro-2-pyridinyl)-6-isocyano-3-azabicyclo[3.1.0]hexane (PubChem CID 153307154) has the molecular formula C11H10FN3 and a molecular weight of 203.22 g/mol. Its IUPAC name is (1R,5S)-3-(4-fluoro-2-pyridinyl)-6-isocyano-3-azabicyclo[3.1.0]hexane.
| Compound Name | (1R,5S)-3-(4-fluoro-2-pyridinyl)-6-isocyano-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 153307154 |
| Molecular Formula | C11H10FN3 |
| Molecular Weight | 203.22 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | (1R,5S)-3-(4-fluoro-2-pyridinyl)-6-isocyano-3-azabicyclo[3.1.0]hexane |
| SMILES | [C-]#[N+]C1[C@H]2CN(c3cc(F)ccn3)C[C@@H]12 |
| InChI | InChI=1S/C11H10FN3/c1-13-11-8-5-15(6-9(8)11)10-4-7(12)2-3-14-10/h2-4,8-9,11H,5-6H2/t8-,9+,11? |
| InChIKey | BCZCCRDJJKYYSH-SLHIUPAKSA-N |
| XLogP | 1.57 |
| TPSA | 20.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.22 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|