C12H14N2 — CID 153307387
1-methyl-2,3,4,5-tetrahydro-1H-pyrido[3,4-b]indole (PubChem CID 153307387) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 1-methyl-2,3,4,5-tetrahydro-1H-pyrido[3,4-b]indole.
| Compound Name | 1-methyl-2,3,4,5-tetrahydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 153307387 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 1-methyl-2,3,4,5-tetrahydro-1H-pyrido[3,4-b]indole |
| SMILES | CC1NCCC2=C3CC=CC=C3N=C21 |
| InChI | InChI=1S/C12H14N2/c1-8-12-10(6-7-13-8)9-4-2-3-5-11(9)14-12/h2-3,5,8,13H,4,6-7H2,1H3 |
| InChIKey | AMWZXUHAXSGMOO-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |