C22H30Si — CID 153307789
dimethyl-(3-propyl-1H-inden-1-yl)-(2,3,4-trimethylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 153307789) has the molecular formula C22H30Si and a molecular weight of 322.57 g/mol. Its IUPAC name is dimethyl-(3-propyl-1H-inden-1-yl)-(2,3,4-trimethylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | dimethyl-(3-propyl-1H-inden-1-yl)-(2,3,4-trimethylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 153307789 |
| Molecular Formula | C22H30Si |
| Molecular Weight | 322.57 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | dimethyl-(3-propyl-1H-inden-1-yl)-(2,3,4-trimethylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | CCCC1=CC([Si](C)(C)C2C=C(C)C(C)=C2C)c2ccccc21 |
| InChI | InChI=1S/C22H30Si/c1-7-10-18-14-22(20-12-9-8-11-19(18)20)23(5,6)21-13-15(2)16(3)17(21)4/h8-9,11-14,21-22H,7,10H2,1-6H3 |
| InChIKey | JOSBFMVJXQVTHJ-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.57 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|