C19H29NSi — CID 101138340
N-[(3-but-3-enyl-1H-inden-1-yl)-dimethylsilyl]-2-methylpropan-2-amine (PubChem CID 101138340) has the molecular formula C19H29NSi and a molecular weight of 299.53 g/mol. Its IUPAC name is N-[(3-but-3-enyl-1H-inden-1-yl)-dimethylsilyl]-2-methylpropan-2-amine.
| Compound Name | N-[(3-but-3-enyl-1H-inden-1-yl)-dimethylsilyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 101138340 |
| Molecular Formula | C19H29NSi |
| Molecular Weight | 299.53 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | N-[(3-but-3-enyl-1H-inden-1-yl)-dimethylsilyl]-2-methylpropan-2-amine |
| SMILES | C=CCCC1=CC([Si](C)(C)NC(C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C19H29NSi/c1-7-8-11-15-14-18(17-13-10-9-12-16(15)17)21(5,6)20-19(2,3)4/h7,9-10,12-14,18,20H,1,8,11H2,2-6H3 |
| InChIKey | PUOQRUQBZSLLBG-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.53 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|