C34H24N4S — CID 153310071
6-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,4-diphenyl-5,6-dihydro-1,3-benzothiazole (PubChem CID 153310071) has the molecular formula C34H24N4S and a molecular weight of 520.66 g/mol. Its IUPAC name is 6-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,4-diphenyl-5,6-dihydro-1,3-benzothiazole.
| Compound Name | 6-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,4-diphenyl-5,6-dihydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 153310071 |
| Molecular Formula | C34H24N4S |
| Molecular Weight | 520.66 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | 6-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,4-diphenyl-5,6-dihydro-1,3-benzothiazole |
| SMILES | C1=c2sc(-c3ccccc3)nc2=C(c2ccccc2)CC1c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C34H24N4S/c1-5-13-23(14-6-1)28-21-27(22-29-30(28)35-34(39-29)26-19-11-4-12-20-26)33-37-31(24-15-7-2-8-16-24)36-32(38-33)25-17-9-3-10-18-25/h1-20,22,27H,21H2 |
| InChIKey | OKIVOGOOYFJIGZ-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.66 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |