C21H41NO — CID 153310445
1,4,5,6,7-penta(propan-2-yl)azepan-2-one (PubChem CID 153310445) has the molecular formula C21H41NO and a molecular weight of 323.57 g/mol. Its IUPAC name is 1,4,5,6,7-penta(propan-2-yl)azepan-2-one.
| Compound Name | 1,4,5,6,7-penta(propan-2-yl)azepan-2-one |
|---|---|
| PubChem CID | 153310445 |
| Molecular Formula | C21H41NO |
| Molecular Weight | 323.57 g/mol |
| Exact Mass | 323.32 |
| IUPAC Name | 1,4,5,6,7-penta(propan-2-yl)azepan-2-one |
| SMILES | CC(C)C1CC(=O)N(C(C)C)C(C(C)C)C(C(C)C)C1C(C)C |
| InChI | InChI=1S/C21H41NO/c1-12(2)17-11-18(23)22(16(9)10)21(15(7)8)20(14(5)6)19(17)13(3)4/h12-17,19-21H,11H2,1-10H3 |
| InChIKey | SXJKZSGCVPKKJA-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.57 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |