C25H22BrNO4 — CID 153311385
(2R)-3-amino-2-(4-bromophenyl)-2-(9H-fluoren-9-ylmethoxycarbonyl)butanoic acid (PubChem CID 153311385) has the molecular formula C25H22BrNO4 and a molecular weight of 480.36 g/mol. Its IUPAC name is (2R)-3-amino-2-(4-bromophenyl)-2-(9H-fluoren-9-ylmethoxycarbonyl)butanoic acid.
| Compound Name | (2R)-3-amino-2-(4-bromophenyl)-2-(9H-fluoren-9-ylmethoxycarbonyl)butanoic acid |
|---|---|
| PubChem CID | 153311385 |
| Molecular Formula | C25H22BrNO4 |
| Molecular Weight | 480.36 g/mol |
| Exact Mass | 479.07 |
| IUPAC Name | (2R)-3-amino-2-(4-bromophenyl)-2-(9H-fluoren-9-ylmethoxycarbonyl)butanoic acid |
| SMILES | CC(N)[C@](C(=O)O)(C(=O)OCC1c2ccccc2-c2ccccc21)c1ccc(Br)cc1 |
| InChI | InChI=1S/C25H22BrNO4/c1-15(27)25(23(28)29,16-10-12-17(26)13-11-16)24(30)31-14-22-20-8-4-2-6-18(20)19-7-3-5-9-21(19)22/h2-13,15,22H,14,27H2,1H3,(H,28,29)/t15?,25-/m0/s1 |
| InChIKey | MIVHUZHVVWFPGV-RZNFBWOTSA-N |
| XLogP | 4.47 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.36 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|