C15H17F3O2 — CID 153313686
8-methyl-8-(2,3,4-trifluorophenyl)-1,4-dioxaspiro[4.5]decane (PubChem CID 153313686) has the molecular formula C15H17F3O2 and a molecular weight of 286.29 g/mol. Its IUPAC name is 8-methyl-8-(2,3,4-trifluorophenyl)-1,4-dioxaspiro[4.5]decane.
| Compound Name | 8-methyl-8-(2,3,4-trifluorophenyl)-1,4-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 153313686 |
| Molecular Formula | C15H17F3O2 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 8-methyl-8-(2,3,4-trifluorophenyl)-1,4-dioxaspiro[4.5]decane |
| SMILES | CC1(c2ccc(F)c(F)c2F)CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C15H17F3O2/c1-14(10-2-3-11(16)13(18)12(10)17)4-6-15(7-5-14)19-8-9-20-15/h2-3H,4-9H2,1H3 |
| InChIKey | HZUXTYLUMWGWKX-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|