C32H44N6O2+2 — CID 153315494
N-(1-butyl-3-methyl-4,5-dihydroimidazol-3-ium-2-yl)-1-[2-[2-[2-[(1-butyl-3-methylimidazol-3-ium-2-carbonyl)amino]phenyl]ethyl]phenyl]methanimine oxide (PubChem CID 153315494) has the molecular formula C32H44N6O2+2 and a molecular weight of 544.74 g/mol. Its IUPAC name is N-(1-butyl-3-methyl-4,5-dihydroimidazol-3-ium-2-yl)-1-[2-[2-[2-[(1-butyl-3-methylimidazol-3-ium-2-carbonyl)amino]phenyl]ethyl]phenyl]methanimine oxide.
| Compound Name | N-(1-butyl-3-methyl-4,5-dihydroimidazol-3-ium-2-yl)-1-[2-[2-[2-[(1-butyl-3-methylimidazol-3-ium-2-carbonyl)amino]phenyl]ethyl]phenyl]methanimine oxide |
|---|---|
| PubChem CID | 153315494 |
| Molecular Formula | C32H44N6O2+2 |
| Molecular Weight | 544.74 g/mol |
| Exact Mass | 544.35 |
| IUPAC Name | N-(1-butyl-3-methyl-4,5-dihydroimidazol-3-ium-2-yl)-1-[2-[2-[2-[(1-butyl-3-methylimidazol-3-ium-2-carbonyl)amino]phenyl]ethyl]phenyl]methanimine oxide |
| SMILES | CCCCN1CC[N+](C)=C1/[N+]([O-])=C\c1ccccc1CCc1ccccc1NC(=O)c1n(CCCC)cc[n+]1C |
| InChI | InChI=1S/C32H43N6O2/c1-5-7-19-36-23-21-34(3)31(36)30(39)33-29-16-12-11-14-27(29)18-17-26-13-9-10-15-28(26)25-38(40)32-35(4)22-24-37(32)20-8-6-2/h9-16,21,23,25H,5-8,17-20,22,24H2,1-4H3/q+1/p+1/b38-25+ |
| InChIKey | AKMSNQWOFLSKHD-XPGZBYHPSA-O |
| XLogP | 4.19 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.74 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|