C20H34N3NaO3 — CID 153316584
sodium (5Z,14Z,19R)-20-azido-19-hydroxyicosa-5,14-dienoate (PubChem CID 153316584) has the molecular formula C20H34N3NaO3 and a molecular weight of 387.50 g/mol. Its IUPAC name is sodium (5Z,14Z,19R)-20-azido-19-hydroxyicosa-5,14-dienoate.
| Compound Name | sodium (5Z,14Z,19R)-20-azido-19-hydroxyicosa-5,14-dienoate |
|---|---|
| PubChem CID | 153316584 |
| Molecular Formula | C20H34N3NaO3 |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | sodium (5Z,14Z,19R)-20-azido-19-hydroxyicosa-5,14-dienoate |
| SMILES | [N-]=[N+]=NC[C@H](O)CCC/C=C\CCCCCCC/C=C\CCCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C20H35N3O3.Na/c21-23-22-18-19(24)16-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15-17-20(25)26;/h8-11,19,24H,1-7,12-18H2,(H,25,26);/q;+1/p-1/b10-8-,11-9-;/t19-;/m1./s1 |
| InChIKey | OXHCWJDMOJOAJT-WXINFZOISA-M |
| XLogP | 1.60 |
| TPSA | 109.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|