C41H53N5O6S2 — CID 160608435
(5Z,14Z,19S)-20-azido-N-[4-[[2-(4-benzoylphenyl)acetyl]amino]phenyl]sulfonyl-19-hydroxyicosa-5,14-dienamide;sulfane (PubChem CID 160608435) has the molecular formula C41H53N5O6S2 and a molecular weight of 776.04 g/mol. Its IUPAC name is (5Z,14Z,19S)-20-azido-N-[4-[[2-(4-benzoylphenyl)acetyl]amino]phenyl]sulfonyl-19-hydroxyicosa-5,14-dienamide;sulfane.
| Compound Name | (5Z,14Z,19S)-20-azido-N-[4-[[2-(4-benzoylphenyl)acetyl]amino]phenyl]sulfonyl-19-hydroxyicosa-5,14-dienamide;sulfane |
|---|---|
| PubChem CID | 160608435 |
| Molecular Formula | C41H53N5O6S2 |
| Molecular Weight | 776.04 g/mol |
| Exact Mass | 775.34 |
| IUPAC Name | (5Z,14Z,19S)-20-azido-N-[4-[[2-(4-benzoylphenyl)acetyl]amino]phenyl]sulfonyl-19-hydroxyicosa-5,14-dienamide;sulfane |
| SMILES | S.[N-]=[N+]=NC[C@@H](O)CCC/C=C\CCCCCCC/C=C\CCCC(=O)NS(=O)(=O)c1ccc(NC(=O)Cc2ccc(C(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C41H51N5O6S.H2S/c42-46-43-32-37(47)21-17-12-10-8-6-4-2-1-3-5-7-9-11-13-18-22-39(48)45-53(51,52)38-29-27-36(28-30-38)44-40(49)31-33-23-25-35(26-24-33)41(50)34-19-15-14-16-20-34;/h8-11,14-16,19-20,23-30,37,47H,1-7,12-13,17-18,21-22,31-32H2,(H,44,49)(H,45,48);1H2/b10-8-,11-9-;/t37-;/m0./s1 |
| InChIKey | RFEMKHQYJKTMSL-ACCCEFFOSA-N |
| XLogP | 8.87 |
| TPSA | 178.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.04 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|