C12H21N — CID 153319014
1-[(2R)-5,5-dimethylhex-3-yn-2-yl]pyrrolidine (PubChem CID 153319014) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is 1-[(2R)-5,5-dimethylhex-3-yn-2-yl]pyrrolidine.
| Compound Name | 1-[(2R)-5,5-dimethylhex-3-yn-2-yl]pyrrolidine |
|---|---|
| PubChem CID | 153319014 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 1-[(2R)-5,5-dimethylhex-3-yn-2-yl]pyrrolidine |
| SMILES | C[C@H](C#CC(C)(C)C)N1CCCC1 |
| InChI | InChI=1S/C12H21N/c1-11(7-8-12(2,3)4)13-9-5-6-10-13/h11H,5-6,9-10H2,1-4H3/t11-/m1/s1 |
| InChIKey | GHVZKHSZKBYOOX-LLVKDONJSA-N |
| XLogP | 2.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|