C8H21NO3P+ — CID 153319099
dimethyl-(2-methylpropyl)-(2-phosphonoethyl)azanium (PubChem CID 153319099) has the molecular formula C8H21NO3P+ and a molecular weight of 210.23 g/mol. Its IUPAC name is dimethyl-(2-methylpropyl)-(2-phosphonoethyl)azanium.
| Compound Name | dimethyl-(2-methylpropyl)-(2-phosphonoethyl)azanium |
|---|---|
| PubChem CID | 153319099 |
| Molecular Formula | C8H21NO3P+ |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | dimethyl-(2-methylpropyl)-(2-phosphonoethyl)azanium |
| SMILES | CC(C)C[N+](C)(C)CCP(=O)(O)O |
| InChI | InChI=1S/C8H20NO3P/c1-8(2)7-9(3,4)5-6-13(10,11)12/h8H,5-7H2,1-4H3,(H-,10,11,12)/p+1 |
| InChIKey | LFMQAJVDBNBVKD-UHFFFAOYSA-O |
| XLogP | 0.90 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|