C36H80N2O8Si10 — CID 153321812
4,5-bis[3-[[[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propyl]benzene-1,2-dicarbonitrile (PubChem CID 153321812) has the molecular formula C36H80N2O8Si10 and a molecular weight of 949.90 g/mol. Its IUPAC name is 4,5-bis[3-[[[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propyl]benzene-1,2-dicarbonitrile.
| Compound Name | 4,5-bis[3-[[[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propyl]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 153321812 |
| Molecular Formula | C36H80N2O8Si10 |
| Molecular Weight | 949.90 g/mol |
| Exact Mass | 948.36 |
| IUPAC Name | 4,5-bis[3-[[[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propyl]benzene-1,2-dicarbonitrile |
| SMILES | C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)CCCc1cc(C#N)c(C#N)cc1CCC[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C36H80N2O8Si10/c1-47(2,3)39-51(11,12)43-55(19,20)45-53(15,16)41-49(7,8)27-23-25-33-29-35(31-37)36(32-38)30-34(33)26-24-28-50(9,10)42-54(17,18)46-56(21,22)44-52(13,14)40-48(4,5)6/h29-30H,23-28H2,1-22H3 |
| InChIKey | SSIRPNVRUIAQKV-UHFFFAOYSA-N |
| XLogP | 11.72 |
| TPSA | 121.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 949.90 |
| LogP ≤ 5 | 11.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|