C32H68N2O6Si8 — CID 153321792
4,5-bis[3-tris(trimethylsilyloxy)silylpropyl]benzene-1,2-dicarbonitrile (PubChem CID 153321792) has the molecular formula C32H68N2O6Si8 and a molecular weight of 801.59 g/mol. Its IUPAC name is 4,5-bis[3-tris(trimethylsilyloxy)silylpropyl]benzene-1,2-dicarbonitrile.
| Compound Name | 4,5-bis[3-tris(trimethylsilyloxy)silylpropyl]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 153321792 |
| Molecular Formula | C32H68N2O6Si8 |
| Molecular Weight | 801.59 g/mol |
| Exact Mass | 800.32 |
| IUPAC Name | 4,5-bis[3-tris(trimethylsilyloxy)silylpropyl]benzene-1,2-dicarbonitrile |
| SMILES | C[Si](C)(C)O[Si](CCCc1cc(C#N)c(C#N)cc1CCC[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C32H68N2O6Si8/c1-41(2,3)35-47(36-42(4,5)6,37-43(7,8)9)23-19-21-29-25-31(27-33)32(28-34)26-30(29)22-20-24-48(38-44(10,11)12,39-45(13,14)15)40-46(16,17)18/h25-26H,19-24H2,1-18H3 |
| InChIKey | DZTURHDUYSCPAN-UHFFFAOYSA-N |
| XLogP | 10.28 |
| TPSA | 102.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.59 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|