C31H41N3 — CID 153324476
N,N,3,5-tetramethyl-4-[[6-[2,4,6-tri(propan-2-yl)phenyl]-2-pyridinyl]methylideneamino]aniline (PubChem CID 153324476) has the molecular formula C31H41N3 and a molecular weight of 455.69 g/mol. Its IUPAC name is N,N,3,5-tetramethyl-4-[[6-[2,4,6-tri(propan-2-yl)phenyl]-2-pyridinyl]methylideneamino]aniline.
| Compound Name | N,N,3,5-tetramethyl-4-[[6-[2,4,6-tri(propan-2-yl)phenyl]-2-pyridinyl]methylideneamino]aniline |
|---|---|
| PubChem CID | 153324476 |
| Molecular Formula | C31H41N3 |
| Molecular Weight | 455.69 g/mol |
| Exact Mass | 455.33 |
| IUPAC Name | N,N,3,5-tetramethyl-4-[[6-[2,4,6-tri(propan-2-yl)phenyl]-2-pyridinyl]methylideneamino]aniline |
| SMILES | Cc1cc(N(C)C)cc(C)c1/N=C/c1cccc(-c2c(C(C)C)cc(C(C)C)cc2C(C)C)n1 |
| InChI | InChI=1S/C31H41N3/c1-19(2)24-16-27(20(3)4)30(28(17-24)21(5)6)29-13-11-12-25(33-29)18-32-31-22(7)14-26(34(9)10)15-23(31)8/h11-21H,1-10H3/b32-18+ |
| InChIKey | LOJJHAIUDQDBCT-KCSSXMTESA-N |
| XLogP | 8.55 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.69 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|