C23H20FN5O2 — CID 153325333
2-[[4-(aminomethyl)-2-pyridinyl]oxy]-N-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]benzamide (PubChem CID 153325333) has the molecular formula C23H20FN5O2 and a molecular weight of 417.44 g/mol. Its IUPAC name is 2-[[4-(aminomethyl)-2-pyridinyl]oxy]-N-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]benzamide.
| Compound Name | 2-[[4-(aminomethyl)-2-pyridinyl]oxy]-N-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 153325333 |
| Molecular Formula | C23H20FN5O2 |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 2-[[4-(aminomethyl)-2-pyridinyl]oxy]-N-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]benzamide |
| SMILES | NCc1ccnc(Oc2ccccc2C(=O)NCc2ccc(-n3ccnc3)c(F)c2)c1 |
| InChI | InChI=1S/C23H20FN5O2/c24-19-11-17(5-6-20(19)29-10-9-26-15-29)14-28-23(30)18-3-1-2-4-21(18)31-22-12-16(13-25)7-8-27-22/h1-12,15H,13-14,25H2,(H,28,30) |
| InChIKey | GYCHHSLOZCNJRY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |